ChemNet > CAS > 4383-06-6 3-Hydroxy-4-methoxybenzyl alcohol
4383-06-6 3-Hydroxy-4-methoxybenzyl alcohol
| product Name |
3-Hydroxy-4-methoxybenzyl alcohol |
| CAS No |
4383-06-6 |
| Synonyms |
Isovanillyl alcohol; 5-(hydroxymethyl)-2-methoxyphenol |
| Molecular Formula |
C8H10O3 |
| Molecular Weight |
154.1632 |
| InChI |
InChI=1/C8H10O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,9-10H,5H2,1H3 |
| EINECS |
224-489-7 |
| Molecular Structure |
|
| Density |
1.226g/cm3 |
| Melting point |
135-137℃ |
| Boiling point |
315.8°C at 760 mmHg |
| Refractive index |
1.57 |
| Flash point |
144.8°C |
| Vapour Pressur |
0.00018mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S22:;
S24/25:;
|
|