ChemNet > CAS > 4896-77-9 Glycine-d5
4896-77-9 Glycine-d5
| product Name |
Glycine-d5 |
| Synonyms |
(2H5)Glycine; (~2~H_5_)glycine; (~2~H_6_)glycinamide |
| Molecular Formula |
C2D6N2O |
| Molecular Weight |
80.1188 |
| InChI |
InChI=1/C2H6N2O/c3-1-2(4)5/h1,3H2,(H2,4,5)/i1D2/hD4 |
| CAS Registry Number |
4896-77-9 |
| EINECS |
225-518-6 |
| Molecular Structure |
|
| Density |
1.213g/cm3 |
| Melting point |
248℃ |
| Boiling point |
281.3°C at 760 mmHg |
| Refractive index |
1.469 |
| Flash point |
123.9°C |
| Vapour Pressur |
0.00359mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
