ChemNet > CAS > 4896-77-9 Glycine-d5
4896-77-9 Glycine-d5
product Name |
Glycine-d5 |
Synonyms |
(2H5)Glycine; (~2~H_5_)glycine; (~2~H_6_)glycinamide |
Molecular Formula |
C2D6N2O |
Molecular Weight |
80.1188 |
InChI |
InChI=1/C2H6N2O/c3-1-2(4)5/h1,3H2,(H2,4,5)/i1D2/hD4 |
CAS Registry Number |
4896-77-9 |
EINECS |
225-518-6 |
Molecular Structure |
|
Density |
1.213g/cm3 |
Melting point |
248℃ |
Boiling point |
281.3°C at 760 mmHg |
Refractive index |
1.469 |
Flash point |
123.9°C |
Vapour Pressur |
0.00359mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|