51-49-0 D-Thyroxine
| product Name |
D-Thyroxine |
| CAS No |
51-49-0 |
| Synonyms |
D-4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzylalanine; D-thyroxine free acid; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine; O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-D-tyrosine |
| Molecular Formula |
C16H13I4NO4 |
| Molecular Weight |
790.8966 |
| InChI |
InChI=1/C16H13I4NO4/c1-7(16(23)24)21-6-8-2-12(19)15(13(20)3-8)25-9-4-10(17)14(22)11(18)5-9/h2-5,7,21-22H,6H2,1H3,(H,23,24)/t7-/m1/s1 |
| EINECS |
200-102-7 |
| Molecular Structure |
|
| Melting point |
225℃ |
| Refractive index |
1.759 |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|