515-00-4 (-)-Myrtenol
| product Name |
(-)-Myrtenol |
| CAS No |
515-00-4 |
| Synonyms |
(-)-pin-2-ene-10-ol; (6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol |
| Molecular Formula |
C10H16O |
| Molecular Weight |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 |
| EINECS |
208-193-5 |
| Molecular Structure |
|
| Density |
0.991g/cm3 |
| Boiling point |
224.8°C at 760 mmHg |
| Refractive index |
1.504 |
| Flash point |
89.4°C |
| Vapour Pressur |
0.0179mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|