ChemNet > CAS > 5413-05-8 Ethyl 2-phenylacetoacetate
5413-05-8 Ethyl 2-phenylacetoacetate
| product Name |
Ethyl 2-phenylacetoacetate |
| Synonyms |
2-Phenylacetoacetic acid ethyl ester; ethyl 3-oxo-2-phenylbutanoate; ethyl (2S)-3-oxo-2-phenylbutanoate |
| Molecular Formula |
C12H14O3 |
| Molecular Weight |
206.2378 |
| InChI |
InChI=1/C12H14O3/c1-3-15-12(14)11(9(2)13)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3/t11-/m1/s1 |
| CAS Registry Number |
5413-05-8 |
| EINECS |
226-500-0 |
| Molecular Structure |
|
| Density |
1.087g/cm3 |
| Boiling point |
281.6°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
119.2°C |
| Vapour Pressur |
0.00354mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
