5707-44-8 4-Ethylbiphenyl
| product Name |
4-Ethylbiphenyl |
| CAS No |
5707-44-8 |
| Synonyms |
1,1'-Biphenyl, 4-ethyl- (9CI); 1-Ethyl-4-phenylbenzene; NSC 60063; p-Ethylbiphenyl; 1,1'-Biphenyl, 4-ethyl-; Biphenyl, 4-ethyl- (8CI); 2-[1-(1,3-benzodioxol-5-ylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-oxoethyl biphenyl-4-ylacetate |
| Molecular Formula |
C30H27NO5 |
| Molecular Weight |
481.5391 |
| InChI |
InChI=1/C30H27NO5/c1-20-14-26(21(2)31(20)17-23-10-13-28-29(15-23)36-19-35-28)27(32)18-34-30(33)16-22-8-11-25(12-9-22)24-6-4-3-5-7-24/h3-15H,16-19H2,1-2H3 |
| Molecular Structure |
|
| Density |
1.21g/cm3 |
| Melting point |
34-35.5℃ |
| Boiling point |
655.8°C at 760 mmHg |
| Refractive index |
1.612 |
| Flash point |
350.4°C |
| Vapour Pressur |
4.5E-17mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Description |
Category:IntermediateStructure Formula: Specifications:Purity:99% Cas No.:5707-44-8 |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Benson Han |
| Telephone |
+86-21-50278900 |
| Email |
sales@chemrole.com |
| Address |
ROOM 201, NO.6,LANE 299,BISHENG ROAD, SHANGHAI,201204, CHINA |
| Telephone |
86-571-81956191 81956192 |
| Email |
Info@sinocochem.com |
| Address |
425 Ruiqi Mansion Moganshan Road , Hangzhou 310011 China. |
| Specifications |
GC¡Ý99.5% |
| Packing |
20kg/drum or on request |
| Description |
Chemical Name: 4-Ethylbiphenyl CAS No. 5707-44-8 Content: GC¡Ý99.5% Appearance: white solid ; Packing: 20kg/drum or on request; Productivity: 10 Tons/M |
| Contact |
Mr.Meng |
| Telephone |
+86-311-83833777 85381176 85381186 |
| Email |
sales@maisonchem.com.cn |
| Address |
Yingbin North Road,Xinji City,Hebei Province,China |