ChemNet > CAS > 5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
5866-98-8 2,6-Dichloro-3-nitrobenzonitrile
| product Name |
2,6-Dichloro-3-nitrobenzonitrile |
| Molecular Formula |
C7H2Cl2N2O2 |
| Molecular Weight |
217.009 |
| InChI |
InChI=1/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| CAS Registry Number |
5866-98-8 |
| Molecular Structure |
|
| Density |
1.61g/cm3 |
| Boiling point |
341.7°C at 760 mmHg |
| Refractive index |
1.615 |
| Flash point |
160.5°C |
| Vapour Pressur |
7.9E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
