ChemNet > CAS > 637-78-5 Isopropyl propionate
637-78-5 Isopropyl propionate
| product Name |
Isopropyl propionate |
| Synonyms |
Isopropyl propionate, (Propionic acid isopropyl ester); Propionic acid isopropyl ester; propan-2-yl propanoate |
| Molecular Formula |
C6H12O2 |
| Molecular Weight |
116.1583 |
| InChI |
InChI=1/C6H12O2/c1-4-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| CAS Registry Number |
637-78-5 |
| EINECS |
211-300-8 |
| Molecular Structure |
|
| Density |
0.883g/cm3 |
| Boiling point |
112.6°C at 760 mmHg |
| Refractive index |
1.395 |
| Flash point |
19.4°C |
| Vapour Pressur |
21.6mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R11:Highly flammable.;
|
| Safety Description |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24:Avoid contact with skin.;
S29:Do not empty into drains.;
S33:Take precautionary measures against static discharges.;
|
|
