ChemNet > CAS > 64-65-3 Bemegride
64-65-3 Bemegride
| product Name |
Bemegride |
| Synonyms |
3-Ethyl-3-methylglutarimide; 4-Ethyl-4-methyl-2,6-piperidinedione; 3-Methyl-3-ethylglutarimide; 4-ethyl-4-methylpiperidine-2,6-dione |
| Molecular Formula |
C8H13NO2 |
| Molecular Weight |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-8(2)4-6(10)9-7(11)5-8/h3-5H2,1-2H3,(H,9,10,11) |
| CAS Registry Number |
64-65-3 |
| EINECS |
200-588-0 |
| Molecular Structure |
|
| Density |
1.024g/cm3 |
| Melting point |
126-129℃ |
| Boiling point |
282°C at 760 mmHg |
| Refractive index |
1.448 |
| Flash point |
125.8°C |
| Vapour Pressur |
0.00344mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
