ChemNet > CAS > 68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
68411-46-1 Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene
| product Name |
Benzenamine, N-phenyl-, reaction products with 2,4,4-trimethylpentene |
| CAS No |
68411-46-1 |
| Synonyms |
N-phenylaniline - 2,4,4-trimethylpent-1-ene (1:1); Antioxidant 5057; Irganox 5057; Quantox-557; Alkyl diphenylamine; AN 5057; N-Phenylbenzenamine reactioin products with 2,4,4-trimethylpentene |
| Molecular Formula |
C20H27N |
| Molecular Weight |
281.4351 |
| InChI |
InChI=1/C12H11N.C8H16/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(3,4)5/h1-10,13H;1,6H2,2-5H3 |
| EINECS |
270-128-1 |
| Molecular Structure |
|
| Boiling point |
302°C at 760 mmHg |
| Flash point |
152.8°C |
| Vapour Pressur |
0.00102mmHg at 25°C |
|