ChemNet > CAS > 7145-99-5 3,4-(Methylenedioxy)toluene
7145-99-5 3,4-(Methylenedioxy)toluene
| product Name |
3,4-(Methylenedioxy)toluene |
| Synonyms |
5-Methyl-1,3-benzodioxole~1-Methyl-3,4-(methylenedioxy)benzene; 5-methyl-1,3-benzodioxole |
| Molecular Formula |
C8H8O2 |
| Molecular Weight |
136.1479 |
| InChI |
InChI=1/C8H8O2/c1-6-2-3-7-8(4-6)10-5-9-7/h2-4H,5H2,1H3 |
| CAS Registry Number |
7145-99-5 |
| EINECS |
230-453-1 |
| Molecular Structure |
|
| Density |
1.164g/cm3 |
| Boiling point |
200.4°C at 760 mmHg |
| Refractive index |
1.55 |
| Flash point |
76.1°C |
| Vapour Pressur |
0.46mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
