CAS No: 74472-49-4, Chemical Name: 2,2',3,4,5,6,6'-heptachlorobiphenyl
the physical and chemical property of 74472-49-4, 2,2',3,4,5,6,6'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
| product Name |
2,2',3,4,5,6,6'-heptachlorobiphenyl |
| Synonyms |
1,1'-biphenyl, 2,2',3,4,5,6,6'-heptachloro-; 2,2',3,4,5,6,6'-Heptachloro-1,1'-biphenyl; 2,2',3,4,5,6,6'-PCB; 74472-49-4 |
| Molecular Formula |
C12H3Cl7 |
| Molecular Weight |
395.3232 |
| InChI |
InChI=1/C12H3Cl7/c13-4-2-1-3-5(14)6(4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
| CAS Registry Number |
74472-49-4 |
| Molecular Structure |
|
| Density |
1.658g/cm3 |
| Boiling point |
395.2°C at 760 mmHg |
| Refractive index |
1.632 |
| Flash point |
189.3°C |
| Vapour Pressur |
4.26E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
