ChemNet > CAS > 7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
7469-83-2 1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid
product Name |
1-(4-Methoxyphenyl)-1-cyclohexanecarboxylic acid |
Synonyms |
2-(4-Chlorophenyl)-2-methylpropionic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylic acid; 1-(4-methoxyphenyl)cyclohexanecarboxylate |
Molecular Formula |
C14H17O3 |
Molecular Weight |
233.2835 |
InChI |
InChI=1/C14H18O3/c1-17-12-7-5-11(6-8-12)14(13(15)16)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3,(H,15,16)/p-1 |
CAS Registry Number |
7469-83-2 |
EINECS |
231-266-8 |
Molecular Structure |
|
Melting point |
172-177℃ |
Boiling point |
389.7°C at 760 mmHg |
Flash point |
145.8°C |
Vapour Pressur |
9E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|