ChemNet > CAS > 74852-61-2 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine
74852-61-2 1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine
| product Name |
1-(4-Methoxyphenyl)-4-(4-nitrophenyl)piperazine |
| CAS No |
74852-61-2 |
| Synonyms |
1-(4-METHYLOXY-PHENYL)-4-(4-NITRO-PHENYL)-PIPERAZINE; 1-(4-Methoxyphonyl)-4-(4-Nitrophenyl)Piperazine; PIPERAZINE,1-(4-METHOXYPHENYL)-4-(4-NITROPHENYL)- |
| Molecular Formula |
C17H19N3O3 |
| Molecular Weight |
313.3511 |
| InChI |
InChI=1/C17H19N3O3/c1-23-17-8-6-15(7-9-17)19-12-10-18(11-13-19)14-2-4-16(5-3-14)20(21)22/h2-9H,10-13H2,1H3 |
| Molecular Structure |
|
| Density |
1.239g/cm3 |
| Boiling point |
515.7°C at 760 mmHg |
| Refractive index |
1.61 |
| Flash point |
265.7°C |
| Vapour Pressur |
9.63E-11mmHg at 25°C |
|
Featured China Suppliers
| Specifications |
Intermediate of Itraconazole |
| Description |
| CAS NO | | Cate | Inte rm ediates | | Product Name | 1-(4-methoxyphonyl)-4-(4-nitrophenyl)piperazine | | molecular formula | C17H19N3O3 | Molecular Weigh | 313.35 | | Structural Formula | | | Standard | ... |
| Telephone |
+86-536-5102364,5103738 |
| Email |
export@shouguangpharm.com |
| Address |
North-East of Dongwaihuan Road, Dongcheng Industrial Area£¬Shouguang City£¬Shandong Province£¬P.R. of China |
| Contact |
Mr.Qin |
| Telephone |
86-21-51879652 |
| Email |
sales@synexpharma.com |
| Address |
Bldg. 8, Xuhui Functional Materials Park, NO. 237, Xi Tai Road, Shanghai, 200232, China |
|