CAS No: 76282-33-2, Chemical Name: 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
the physical and chemical property of 76282-33-2, 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane is provided by ChemNet.com
ChemNet > CAS > 76282-33-2 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
76282-33-2 1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane
| product Name |
1,4,7,10-tetramethyl-1,4,7,10-tetraazacyclododecane |
| Synonyms |
Tetraazatetramethyl-12-crown-4 |
| Molecular Formula |
C12H28N4 |
| Molecular Weight |
228.3775 |
| InChI |
InChI=1/C12H28N4/c1-13-5-7-14(2)9-11-16(4)12-10-15(3)8-6-13/h5-12H2,1-4H3 |
| CAS Registry Number |
76282-33-2 |
| Molecular Structure |
|
| Density |
0.888g/cm3 |
| Boiling point |
281.6°C at 760 mmHg |
| Refractive index |
1.456 |
| Flash point |
109.1°C |
| Vapour Pressur |
0.00354mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
