ChemNet > CAS > 81012-96-6 2,4-Diamino-6-mercaptopyrimidine hemisulfate
81012-96-6 2,4-Diamino-6-mercaptopyrimidine hemisulfate
product Name |
2,4-Diamino-6-mercaptopyrimidine hemisulfate |
Synonyms |
2,6-Diamino-4-pyrimidinethiol,hemisulfate; 2,6-diaminopyrimidine-4(1H)-thione; 2,6-diaminopyrimidine-4-thiolate |
Molecular Formula |
C4H5N4S |
Molecular Weight |
141.1748 |
InChI |
InChI=1/C4H6N4S/c5-2-1-3(9)8-4(6)7-2/h1H,(H5,5,6,7,8,9)/p-1 |
CAS Registry Number |
81012-96-6 |
EINECS |
279-657-2 |
Molecular Structure |
|
Melting point |
300℃ |
Boiling point |
479.9°C at 760 mmHg |
Flash point |
244.1°C |
Vapour Pressur |
2.26E-09mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|