ChemNet > CAS > 824-78-2 Sodium 4-nitrophenoxide, hydrate
824-78-2 Sodium 4-nitrophenoxide, hydrate
| product Name |
Sodium 4-nitrophenoxide, hydrate |
| CAS No |
824-78-2 |
| Synonyms |
4-Nitrophenol sodium salt; sodium p-nitrophenolate; 4-Nitropheol Sodium Salt; P-Nitro phenol sodium salt; Sodium 4-nitrophenoxide; sodium 4-nitrophenolate |
| Molecular Formula |
C6H4NNaO3 |
| Molecular Weight |
161.0906 |
| InChI |
InChI=1/C6H5NO3.Na/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,8H;/q;+1/p-1 |
| EINECS |
212-536-4 |
| Molecular Structure |
|
| Melting point |
300℃ |
| Boiling point |
279°C at 760 mmHg |
| Flash point |
141.9°C |
| Vapour Pressur |
0.00243mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:;
R33:;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|