ChemNet > CAS > 93-84-5 5-Nitro-2-benzimidazolinone
93-84-5 5-Nitro-2-benzimidazolinone
product Name |
5-Nitro-2-benzimidazolinone |
Synonyms |
2H-Benzimidazol-2-one, 1,3-dihydro-5-nitro-; 2-Hydroxy-5-nitrobenzimidazole; 5-Nitro-2(3H)-benzimidazolone; 5-Nitrobenzimidazol-2-one; NSC 10380; 1,3-Dihydro-5-nitro-2H-benzimidazol-2-one; 2-Benzimidazolinone, 5-nitro- (8CI); 5-nitro-2H-benzimidazol-2-one |
Molecular Formula |
C7H3N3O3 |
Molecular Weight |
177.117 |
InChI |
InChI=1/C7H3N3O3/c11-7-8-5-2-1-4(10(12)13)3-6(5)9-7/h1-3H |
CAS Registry Number |
93-84-5 |
EINECS |
202-282-2 |
Molecular Structure |
|
Density |
1.76g/cm3 |
Boiling point |
278°C at 760 mmHg |
Refractive index |
1.786 |
Flash point |
121.9°C |
Vapour Pressur |
0.00438mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|