107-84-6 1-Chloro-3-methylbutane
Ονομασία του προϊόντος |
1-Chloro-3-methylbutane |
Αγγλικό όνομα |
1-Chloro-3-methylbutane; Isoamyl chloride~Isopentyl chloride |
MF |
C5H11Cl |
Μοριακό βάρος |
106.5938 |
InChI |
InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
CAS ΟΧΙ |
107-84-6 |
EINECS |
203-525-5 |
Μοριακή δομή |
|
Πυκνότητα |
0.867g/cm3 |
Σημείο βρασμού |
98.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.403 |
Σημείο ανάφλεξης |
9.8°C |
Πίεση ατμών |
46.2mmHg at 25°C |
Κινδύνου Κώδικες |
R11:Highly flammable.;
|
Περιγραφή της ασφάλειας |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|