ChemNet > CAS > 131076-14-7 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride
131076-14-7 4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride
| Ονομασία του προϊόντος |
4,5-Dimethoxy-1,2-phenylenediamine dihydrochloride |
| Συνώνυμα |
1,2-Diamino-4,5-dimethoxybenzene, dihydrochloride (DDB); 4,5-dimethoxybenzene-1,2-diamine dihydrochloride |
| MF |
C8H14Cl2N2O2 |
| Μοριακό βάρος |
241.115 |
| InChI |
InChI=1/C8H12N2O2.2ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;;/h3-4H,9-10H2,1-2H3;2*1H |
| CAS ΟΧΙ |
131076-14-7 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
385.7°C at 760 mmHg |
| Σημείο ανάφλεξης |
187.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
