ChemNet > CAS > 133-49-3 Penta-Chloro Thiophenol
133-49-3 Penta-Chloro Thiophenol
Ονομασία του προϊόντος |
Penta-Chloro Thiophenol |
Συνώνυμα |
Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
MF |
C6HCl5S |
Μοριακό βάρος |
282.4021 |
InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
CAS ΟΧΙ |
133-49-3 |
EINECS |
205-107-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.745g/cm3 |
Σημείο τήξης |
223-227℃ |
Σημείο βρασμού |
351.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.648 |
Σημείο ανάφλεξης |
144.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|