ChemNet > CAS > 133-49-3 Penta-Chloro Thiophenol
133-49-3 Penta-Chloro Thiophenol
| Ονομασία του προϊόντος |
Penta-Chloro Thiophenol |
| Συνώνυμα |
Pentachlorobenzenethiol; Pentachlorothiophenol; 2,3,4,5,6-Pentachlorobenzenethiol; Benzenethiol,pentachloro- (6CI,7CI,8CI,9CI); Benzenethiol,2,3,4,5,6-pentachloro- |
| MF |
C6HCl5S |
| Μοριακό βάρος |
282.4021 |
| InChI |
InChI=1/C6HCl5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| CAS ΟΧΙ |
133-49-3 |
| EINECS |
205-107-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.745g/cm3 |
| Σημείο τήξης |
223-227℃ |
| Σημείο βρασμού |
351.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.648 |
| Σημείο ανάφλεξης |
144.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/22:Harmful by inhalation and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
