ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
Ονομασία του προϊόντος |
2-Bromo-6-fluorotoluene |
Συνώνυμα |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
MF |
C7H4ClFN2S |
Μοριακό βάρος |
202.6365 |
InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
CAS ΟΧΙ |
1422-54-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.63g/cm3 |
Σημείο βρασμού |
294°C at 760 mmHg |
Δείκτης διάθλασης |
1.714 |
Σημείο ανάφλεξης |
131.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|