ChemNet > CAS > 144284-24-2 2,3,4-trifluorobenzyl alcohol
144284-24-2 2,3,4-trifluorobenzyl alcohol
Ονομασία του προϊόντος |
2,3,4-trifluorobenzyl alcohol |
Συνώνυμα |
1,2,3-trifluoro-4-methoxybenzene; (2,3,4-trifluorophenyl)methanol |
MF |
C7H5F3O |
Μοριακό βάρος |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2,11H,3H2 |
CAS ΟΧΙ |
144284-24-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.398g/cm3 |
Σημείο βρασμού |
195.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.476 |
Σημείο ανάφλεξης |
84.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|