ChemNet > CAS > 1732-08-7 Dimethyl pimelate
1732-08-7 Dimethyl pimelate
| Ονομασία του προϊόντος |
Dimethyl pimelate |
| Συνώνυμα |
Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| MF |
C9H16O4 |
| Μοριακό βάρος |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| CAS ΟΧΙ |
1732-08-7 |
| EINECS |
217-057-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.022g/cm3 |
| Σημείο βρασμού |
250.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.427 |
| Σημείο ανάφλεξης |
105.4°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
