ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
Ονομασία του προϊόντος |
4-fluoro-2-(trifluoromethyl)acetophenone |
Συνώνυμα |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
MF |
C9H9FO2 |
Μοριακό βάρος |
168.165 |
InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
CAS ΟΧΙ |
208173-21-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.127g/cm3 |
Σημείο βρασμού |
246°C at 760 mmHg |
Δείκτης διάθλασης |
1.487 |
Σημείο ανάφλεξης |
99.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|