ChemNet > CAS > 233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
233585-04-1 2,6-dihydroxy-3-nitrobenzonitrile
| Ονομασία του προϊόντος |
2,6-dihydroxy-3-nitrobenzonitrile |
| MF |
C7H4N2O4 |
| Μοριακό βάρος |
180.1177 |
| InChI |
InChI=1/C7H4N2O4/c8-3-4-6(10)2-1-5(7(4)11)9(12)13/h1-2,10-11H |
| CAS ΟΧΙ |
233585-04-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.69g/cm3 |
| Σημείο τήξης |
238℃ |
| Σημείο βρασμού |
358.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.683 |
| Σημείο ανάφλεξης |
170.5°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
