ChemNet > CAS > 25153-40-6 Methyl vinyl ether/maleic acid copolymer
25153-40-6 Methyl vinyl ether/maleic acid copolymer
Ονομασία του προϊόντος |
Methyl vinyl ether/maleic acid copolymer |
Συνώνυμα |
Poly(methyl vinyl ether-alt-maleic acid); methoxyethene-(2Z)-but-2-enedioic acid (1:1); poly(methyl vinyl ether/maleic acid)copolymer |
MF |
C7H10O5 |
Μοριακό βάρος |
174.1513 |
InChI |
InChI=1/C4H4O4.C3H6O/c5-3(6)1-2-4(7)8;1-3-4-2/h1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2-1-; |
CAS ΟΧΙ |
25153-40-6 |
Μοριακή δομή |
|
Σημείο βρασμού |
355.5°C at 760 mmHg |
Σημείο ανάφλεξης |
183°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|