ChemNet > CAS > 26643-91-4 4-methyl-2-phenyl-2-pentenal
26643-91-4 4-methyl-2-phenyl-2-pentenal
| Ονομασία του προϊόντος |
4-methyl-2-phenyl-2-pentenal |
| Αγγλικό όνομα |
4-methyl-2-phenyl-2-pentenal;Benzeneacetaldehyde, alpha-(2-methylpropylidene)-; 2-Pentenal, 4-methyl-2-phenyl-; 4-Methyl-2-phenyl-2-pentenal; 4-Methyl-2-phenyl-2-penteral; 4-Methyl-2-phenyl-2-penteral (natural); FEMA No. 3200; alpha-(2-Methylpropylidene)benzeneacetaldehyde; alpha-Isobutylidenebenzeneacetaldehyde; 4-methyl-2-phenylpent-2-enal; (2Z)-4-methyl-2-phenylpent-2-enal; (2E)-4-methyl-2-phenylpent-2-enal |
| MF |
C12H14O |
| Μοριακό βάρος |
174.239 |
| InChI |
InChI=1/C12H14O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8- |
| CAS ΟΧΙ |
26643-91-4 |
| EINECS |
247-869-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.962g/cm3 |
| Σημείο βρασμού |
295.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.517 |
| Σημείο ανάφλεξης |
113.9°C |
| Πίεση ατμών |
0.00156mmHg at 25°C |
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|