ChemNet > CAS > 3278-35-1 diethyl thiodicarbonate
3278-35-1 diethyl thiodicarbonate
| Ονομασία του προϊόντος |
diethyl thiodicarbonate |
| Συνώνυμα |
Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), OC,OC'-diethyl ester; AI3-19742; Ethyl xanthogen ethyl formate; NSC 403191; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiocarbonate; Xanthic acid, ethyl-, anhydrosulfide with O-ethyl thiolcarbonate; Carbonic acid, dithio-, anhydrosulfide with O-ethyl thiocarbonate, O-ethyl ester (8CI); Diethyl thiodicarbonate ((OH)C(O)SC(S)(OH)); Thiodicarbonic acid ((HO)C(O)SC(S)(OH)), diethyl ester; Thiodicarbonic acid, diethyl ester; O,O-diethyl dithiodicarbonate |
| MF |
C6H10O3S2 |
| Μοριακό βάρος |
194.2718 |
| InChI |
InChI=1/C6H10O3S2/c1-3-8-5(7)11-6(10)9-4-2/h3-4H2,1-2H3 |
| CAS ΟΧΙ |
3278-35-1 |
| EINECS |
221-911-1 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.242g/cm3 |
| Σημείο βρασμού |
236°C at 760 mmHg |
| Δείκτης διάθλασης |
1.534 |
| Σημείο ανάφλεξης |
96.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
|
|
