ChemNet > CAS > 35271-74-0 3-(4-Chlorophenyl)glutaric acid
35271-74-0 3-(4-Chlorophenyl)glutaric acid
Ονομασία του προϊόντος |
3-(4-Chlorophenyl)glutaric acid |
Συνώνυμα |
3-(4-chlorophenyl glutaric acid); 3-(4-chlorophenyl)pentanedioic acid; 3-(4-chlorophenyl)pentanedioate; β-(4-chlorophenyl)Glutaric acid |
MF |
C11H9ClO4 |
Μοριακό βάρος |
240.6409 |
InChI |
InChI=1/C11H11ClO4/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H,13,14)(H,15,16)/p-2 |
CAS ΟΧΙ |
35271-74-0 |
EINECS |
252-477-1 |
Μοριακή δομή |
|
Σημείο βρασμού |
394.4°C at 760 mmHg |
Σημείο ανάφλεξης |
192.3°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|