CAS No: 38411-25-5, Chemical Name: 2,2',3,3',4,5,6'-heptachlorobiphenyl
the physical and chemical property of 38411-25-5, 2,2',3,3',4,5,6'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 38411-25-5 2,2',3,3',4,5,6'-heptachlorobiphenyl
38411-25-5 2,2',3,3',4,5,6'-heptachlorobiphenyl
Ονομασία του προϊόντος |
2,2',3,3',4,5,6'-heptachlorobiphenyl |
Συνώνυμα |
1,1'-biphenyl, 2,2',3,3',4,5,6'-heptachloro-; 2,2',3,3',4,5,6'-HEPTACHLOROBIPHENYL; 2,2',3,3',4,5,6'-PCB; 38411-25-5 |
MF |
C12H3Cl7 |
Μοριακό βάρος |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-5-1-2-6(14)10(17)8(5)4-3-7(15)11(18)12(19)9(4)16/h1-3H |
CAS ΟΧΙ |
38411-25-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.658g/cm3 |
Σημείο βρασμού |
411.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.632 |
Σημείο ανάφλεξης |
201.6°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|