116632-39-4 Bromoiodotoluene
termék neve |
Bromoiodotoluene |
Angol név |
Bromoiodotoluene; 5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
MF |
C7H6BrI |
Molekulatömeg |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
CAS-szám |
116632-39-4 |
Molekuláris szerkezete |
|
Sűrűség |
2.062g/cm3 |
Forráspont |
264.2°C at 760 mmHg |
Törésmutató |
1.636 |
Gyulladáspont |
113.6°C |
Gőznyomás |
0.0161mmHg at 25°C |
Kockázatot kódok |
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|