ChemNet > CAS > 126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
126120-85-2 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
termék neve |
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid |
Angol név |
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid; |
MF |
C8H4F2O4 |
Molekulatömeg |
202.1118 |
InChI |
InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12) |
CAS-szám |
126120-85-2 |
Molekuláris szerkezete |
|
Sűrűség |
1.66g/cm3 |
Forráspont |
260.8°C at 760 mmHg |
Törésmutató |
1.561 |
Gyulladáspont |
111.5°C |
Gőznyomás |
0.0061mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|