ChemNet > CAS > 13679-73-7 2-Acetyl-4-methylthiophene
13679-73-7 2-Acetyl-4-methylthiophene
| termék neve |
2-Acetyl-4-methylthiophene |
| Szinonimák |
1-(4-Methyl-2-thienyl)ethan-1-one; AI3-61742; Ethanone, 1-(4-methyl-2-thienyl)-; 1-(4-methylthiophen-2-yl)ethanone |
| MF |
C7H8OS |
| Molekulatömeg |
140.2028 |
| InChI |
InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
| CAS-szám |
13679-73-7 |
| EINECS |
237-180-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.106g/cm3 |
| Forráspont |
236.9°C at 760 mmHg |
| Törésmutató |
1.535 |
| Gyulladáspont |
97.1°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
