ChemNet > CAS > 1443-76-1 3,5-Dimethoxy-4-hydroxybenzhydrazide
1443-76-1 3,5-Dimethoxy-4-hydroxybenzhydrazide
termék neve |
3,5-Dimethoxy-4-hydroxybenzhydrazide |
Angol név |
3,5-Dimethoxy-4-hydroxybenzhydrazide; 4-Hydroxy-3,5-dimethoxybenzohydrazide; Benzoic acid, 4-hydroxy-3,5-dimethoxy-, hydrazide |
MF |
C9H12N2O4 |
Molekulatömeg |
212.2026 |
InChI |
InChI=1/C9H12N2O4/c1-14-6-3-5(9(13)11-10)4-7(15-2)8(6)12/h3-4,12H,10H2,1-2H3,(H,11,13) |
CAS-szám |
1443-76-1 |
EINECS |
215-884-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.298g/cm3 |
Törésmutató |
1.575 |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|