ChemNet > CAS > 15329-69-8 N-Benzylmaleamic acid
15329-69-8 N-Benzylmaleamic acid
termék neve |
N-Benzylmaleamic acid |
Szinonimák |
Maleic acid monobenzylamide; 4-(benzylamino)-4-oxobut-2-enoic acid; (2Z)-4-(benzylamino)-4-oxobut-2-enoic acid; (2E)-4-(benzylamino)-4-oxobut-2-enoate |
MF |
C11H10NO3 |
Molekulatömeg |
204.2025 |
InChI |
InChI=1/C11H11NO3/c13-10(6-7-11(14)15)12-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,12,13)(H,14,15)/p-1/b7-6+ |
CAS-szám |
15329-69-8 |
EINECS |
239-361-6 |
Molekuláris szerkezete |
|
Olvadáspont |
136-138℃ |
Forráspont |
476.3°C at 760 mmHg |
Gyulladáspont |
241.9°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|