ChemNet > CAS > 17213-57-9 3,5-Dimethoxybenzoyl chloride
17213-57-9 3,5-Dimethoxybenzoyl chloride
termék neve |
3,5-Dimethoxybenzoyl chloride |
MF |
C9H9ClO3 |
Molekulatömeg |
200.619 |
InChI |
InChI=1/C9H9ClO3/c1-12-7-3-6(9(10)11)4-8(5-7)13-2/h3-5H,1-2H3 |
CAS-szám |
17213-57-9 |
EINECS |
241-256-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.224g/cm3 |
Olvadáspont |
41-47℃ |
Forráspont |
284.5°C at 760 mmHg |
Törésmutató |
1.52 |
Gyulladáspont |
131.1°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|