ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
termék neve |
2,4,6-Trifluorobenzeneboronic acid |
Angol név |
2,4,6-Trifluorobenzeneboronic acid; 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Molekulatömeg |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
CAS-szám |
182482-25-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.44g/cm3 |
Olvadáspont |
228-235℃ |
Forráspont |
266°C at 760 mmHg |
Törésmutató |
1.465 |
Gyulladáspont |
114.6°C |
Gőznyomás |
0.00444mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|