ChemNet > CAS > 2001-93-6 Dithiouracil
2001-93-6 Dithiouracil
termék neve |
Dithiouracil |
Szinonimák |
2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
MF |
C4H4N2S2 |
Molekulatömeg |
144.218 |
InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
CAS-szám |
2001-93-6 |
EINECS |
217-894-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.5g/cm3 |
Olvadáspont |
279-281℃ |
Forráspont |
225.6°C at 760 mmHg |
Törésmutató |
1.776 |
Gyulladáspont |
90.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|