ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
| termék neve |
(4-Methoxy-2-methylphenyl)boronic acid |
| Szinonimák |
4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
| MF |
C8H11BO3 |
| Molekulatömeg |
165.9821 |
| InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
| CAS-szám |
208399-66-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.14g/cm3 |
| Forráspont |
327.1°C at 760 mmHg |
| Törésmutató |
1.52 |
| Gyulladáspont |
151.6°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
