ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
termék neve |
(4-Methoxy-2-methylphenyl)boronic acid |
Szinonimák |
4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
MF |
C8H11BO3 |
Molekulatömeg |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
CAS-szám |
208399-66-0 |
Molekuláris szerkezete |
|
Sűrűség |
1.14g/cm3 |
Forráspont |
327.1°C at 760 mmHg |
Törésmutató |
1.52 |
Gyulladáspont |
151.6°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|