ChemNet > CAS > 213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
termék neve |
(S)-2-Isobutylsuccinic acid-1-methyl ester |
Szinonimák |
(S)-3-Methoxycarbonyl-5-methylhexanoic acid; (S)-(-)-2-Isobutylsuccinic acid 1-methyl ester; (3S)-3-(methoxycarbonyl)-5-methylhexanoic acid; (3S)-3-(methoxycarbonyl)-5-methylhexanoate; 3-(methoxycarbonyl)-5-methylhexanoic acid |
MF |
C9H16O4 |
Molekulatömeg |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-6(2)4-7(5-8(10)11)9(12)13-3/h6-7H,4-5H2,1-3H3,(H,10,11) |
CAS-szám |
213270-36-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.07g/cm3 |
Forráspont |
288.632°C at 760 mmHg |
Törésmutató |
1.447 |
Gyulladáspont |
107.989°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|