ChemNet > CAS > 25569-97-5 Thiophene-2-carboxylic acid anhydride
25569-97-5 Thiophene-2-carboxylic acid anhydride
termék neve |
Thiophene-2-carboxylic acid anhydride |
Angol név |
Thiophene-2-carboxylic acid anhydride; Thiophene-2-carboxylic anhydride; 2-Thienic anhydride |
MF |
C10H6O3S2 |
Molekulatömeg |
238.2828 |
InChI |
InChI=1/C10H6O3S2/c11-9(7-3-1-5-14-7)13-10(12)8-4-2-6-15-8/h1-6H |
CAS-szám |
25569-97-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.438g/cm3 |
Forráspont |
381.3°C at 760 mmHg |
Törésmutató |
1.64 |
Gyulladáspont |
184.4°C |
Gőznyomás |
5.11E-06mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|