ChemNet > CAS > 31545-26-3 4-klór-3-nitrofenil-ciklopropil-keton
31545-26-3 4-klór-3-nitrofenil-ciklopropil-keton
| termék neve |
4-klór-3-nitrofenil-ciklopropil-keton |
| Szinonimák |
(4-klór-3-nitrofenil) (ciklopropil)metanon |
| Angol név |
4-Chloro-3-nitrophenyl cyclopropyl ketone;(4-chloro-3-nitrophenyl)(cyclopropyl)methanone |
| MF |
C10H8ClNO3 |
| Molekulatömeg |
225.6284 |
| InChI |
InChI=1/C10H8ClNO3/c11-8-4-3-7(5-9(8)12(14)15)10(13)6-1-2-6/h3-6H,1-2H2 |
| CAS-szám |
31545-26-3 |
| EINECS |
250-690-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.464g/cm3 |
| Olvadáspont |
78-80℃ |
| Forráspont |
333.4°C at 760 mmHg |
| Törésmutató |
1.631 |
| Gyulladáspont |
155.4°C |
| Gőznyomás |
0.000137mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|