ChemNet > CAS > 31909-58-7 2-Furoylacetonitrile
31909-58-7 2-Furoylacetonitrile
termék neve |
2-Furoylacetonitrile |
Szinonimák |
3-(furan-2-yl)-3-oxopropanenitrile |
MF |
C7H5NO2 |
Molekulatömeg |
135.1201 |
InChI |
InChI=1/C7H5NO2/c8-4-3-6(9)7-2-1-5-10-7/h1-2,5H,3H2 |
CAS-szám |
31909-58-7 |
Molekuláris szerkezete |
|
Sűrűség |
1.188g/cm3 |
Olvadáspont |
76-83℃ |
Forráspont |
297.2°C at 760 mmHg |
Törésmutató |
1.494 |
Gyulladáspont |
133.6°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|