ChemNet > CAS > 32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
32890-89-4 2-Chloro-6-fluoro-3-methylbenzoic acid
| termék neve |
2-Chloro-6-fluoro-3-methylbenzoic acid |
| Angol név |
2-Chloro-6-fluoro-3-methylbenzoic acid; 2-Chloro-6-fluoro-m-toluic acid |
| MF |
C8H6ClFO2 |
| Molekulatömeg |
188.5834 |
| InChI |
InChI=1/C8H6ClFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3H,1H3,(H,11,12) |
| CAS-szám |
32890-89-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.403g/cm3 |
| Forráspont |
278.1°C at 760 mmHg |
| Törésmutató |
1.551 |
| Gyulladáspont |
122°C |
| Gőznyomás |
0.00209mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|