ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
termék neve |
4-Chloro-3-nitrocoumarin |
Angol név |
4-Chloro-3-nitrocoumarin;4-chloro-3-nitro-2H-chromen-2-one |
MF |
C9H4ClNO4 |
Molekulatömeg |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
CAS-szám |
38464-20-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.6g/cm3 |
Olvadáspont |
160-164℃ |
Forráspont |
338.7°C at 760 mmHg |
Törésmutató |
1.642 |
Gyulladáspont |
158.6°C |
Gőznyomás |
9.68E-05mmHg at 25°C |
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|