ChemNet > CAS > 5414-99-3 Glutaranilic Acid
5414-99-3 Glutaranilic Acid
| termék neve |
Glutaranilic Acid |
| Szinonimák |
N-Phenylglutaramic Acid; Pentanedioic acid mono(N-phenyl)amide; 5-oxo-5-(phenylamino)pentanoic acid; 5-oxo-5-(phenylamino)pentanoate |
| MF |
C11H12NO3 |
| Molekulatömeg |
206.2184 |
| InChI |
InChI=1/C11H13NO3/c13-10(7-4-8-11(14)15)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)(H,14,15)/p-1 |
| CAS-szám |
5414-99-3 |
| Molekuláris szerkezete |
|
| Forráspont |
478.5°C at 760 mmHg |
| Gyulladáspont |
243.2°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
