ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
termék neve |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
MF |
C4H3ClN2OS |
Molekulatömeg |
162.5974 |
InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
CAS-szám |
59944-65-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.504g/cm3 |
Forráspont |
239.9°C at 760 mmHg |
Törésmutató |
1.578 |
Gyulladáspont |
98.9°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|