ChemNet > CAS > 625-48-9 2-Nitroethanol
625-48-9 2-Nitroethanol
termék neve |
2-Nitroethanol |
Szinonimák |
1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
MF |
C2H5NO3 |
Molekulatömeg |
91.07 |
InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
CAS-szám |
625-48-9 |
EINECS |
210-895-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.267g/cm3 |
Forráspont |
193.8°C at 760 mmHg |
Törésmutató |
1.438 |
Gyulladáspont |
113.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|