ChemNet > CAS > 67386-38-3 2-phenoxyethanimidamide hydrochloride
67386-38-3 2-phenoxyethanimidamide hydrochloride
| termék neve |
2-phenoxyethanimidamide hydrochloride |
| Szinonimák |
(1Z)-2-phenoxyethanimidamide; (1Z)-2-phenoxyethanimidamide hydrochloride |
| MF |
C8H11ClN2O |
| Molekulatömeg |
186.6387 |
| InChI |
InChI=1/C8H10N2O.ClH/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H3,9,10);1H |
| CAS-szám |
67386-38-3 |
| Molekuláris szerkezete |
|
| Forráspont |
269.3°C at 760 mmHg |
| Gyulladáspont |
116.7°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
